| Primary information |
|---|
| PRRID | PRRID_2544 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Activation of CLRs. |
| Name of receptor | rCaNTC |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Carassius auratus |
| Localization | Liver |
| Domain | Carbohydrate recognition domain (CRD) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | pathogen recognition in Qihe 538 crucian carp |
| Assay used | Microbial binding assay |
| PMID | 28602683 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2544 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Activation of CLRs. |
| Name of receptor | rCaNTC |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Carassius auratus |
| Localization | Liver |
| Domain | Carbohydrate recognition domain (CRD) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | pathogen recognition in Qihe 538 crucian carp |
| Assay used | Microbial binding assay |
| PMID | 28602683 |
| Year of Publication | 2017 |
| Pubchem assay | NA |