| Primary information |
|---|
| PRRID | PRRID_2543 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | P. gulae (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Causes inflammation and activation of NOD2. |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | HEK cells |
| Domain | NA |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | activate NF-κB. |
| Assay used | NA |
| PMID | 28630066 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2543 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | P. gulae (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Causes inflammation and activation of NOD2. |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | HEK cells |
| Domain | NA |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | activate NF-κB. |
| Assay used | NA |
| PMID | 28630066 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |