Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_2539 details |
| Primary information | |
|---|---|
| PRRID | PRRID_2539 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | AmphiCTL1 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | B. belcheri |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 29055189 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_2539 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | AmphiCTL1 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | B. belcheri |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 29055189 |
| Year of Publication | 2017 |
| Pubchem assay | NA |