| Primary information |
|---|
| PRRID | PRRID_2355 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | Pf_Toll-like receptor 21 (TLR21) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Pelteobagrus fulvidraco |
| Localization | isolated peripheral blood lymphocytes |
| Domain | LRR and TIR domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | activate NF-κB. |
| Assay used | qRT-PCR |
| PMID | 28546018 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2355 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | Pf_Toll-like receptor 21 (TLR21) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Pelteobagrus fulvidraco |
| Localization | isolated peripheral blood lymphocytes |
| Domain | LRR and TIR domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | activate NF-κB. |
| Assay used | qRT-PCR |
| PMID | 28546018 |
| Year of Publication | 2017 |
| Pubchem assay | NA |