| Primary information |
|---|
| PRRID | PRRID_2353 |
| Ligand Name | muropeptides with a meso-diaminopimelate residue (meso-DAP) |
| Source | Gram negative bacteria(Leptospira spp.) |
| Sequence of ligand | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | NA |
| Assay used | NA |
| PMID | 29038956 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2353 |
| Ligand Name | muropeptides with a meso-diaminopimelate residue (meso-DAP) |
| Source | Gram negative bacteria(Leptospira spp.) |
| Sequence of ligand | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | NA |
| Assay used | NA |
| PMID | 29038956 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |