Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_2351 details |
| Primary information | |
|---|---|
| PRRID | PRRID_2351 |
| Ligand Name | muramyl dipeptide (MDP) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | NA |
| Assay used | NA |
| PMID | 29038956 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information | |
|---|---|
| PRRID | PRRID_2351 |
| Ligand Name | muramyl dipeptide (MDP) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | NA |
| Assay used | NA |
| PMID | 29038956 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |