Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_2341 details |
| Primary information | |
|---|---|
| PRRID | PRRID_2341 |
| Ligand Name | MDP (muramyldipeptide) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nod-like receptor P3 (NLRP3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Rat |
| Localization | primary astrocytes |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | protein ‚Üë, activation of NLRP3 inflammasome in PD models |
| Assay used | NA |
| PMID | 28801521 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_2341 |
| Ligand Name | MDP (muramyldipeptide) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nod-like receptor P3 (NLRP3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Rat |
| Localization | primary astrocytes |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | protein ‚Üë, activation of NLRP3 inflammasome in PD models |
| Assay used | NA |
| PMID | 28801521 |
| Year of Publication | 2017 |
| Pubchem assay | NA |