| Primary information |
|---|
| PRRID | PRRID_2321 |
| Ligand Name | M-Tri-DAP |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)NC(CCCC(C(=O)O)N)C(=O)O)C(=O)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Synthetic |
| Role of Ligand | Agonist recognition triggers receptor oligomerization and recruitment of signaling molecules that drive NF-κB-mediated expression of inflammatory cytokines |
| Name of receptor | Nod-like receptor C2 (NLRC2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Intracellular |
| Domain | C-terminal leucine-rich regions and NOD domains |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | triggering production of β-defensins via an NF-κB signaling pathway |
| Assay used | NA |
| PMID | 28776416 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2321 |
| Ligand Name | M-Tri-DAP |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)NC(CCCC(C(=O)O)N)C(=O)O)C(=O)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Synthetic |
| Role of Ligand | Agonist recognition triggers receptor oligomerization and recruitment of signaling molecules that drive NF-κB-mediated expression of inflammatory cytokines |
| Name of receptor | Nod-like receptor C2 (NLRC2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Intracellular |
| Domain | C-terminal leucine-rich regions and NOD domains |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | triggering production of β-defensins via an NF-κB signaling pathway |
| Assay used | NA |
| PMID | 28776416 |
| Year of Publication | 2017 |
| Pubchem assay | NA |