| Primary information |
|---|
| PRRID | PRRID_2318 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Pf_Toll-like receptor 19 (TLR19) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Pelteobagrus fulvidraco |
| Localization | isolated peripheral blood lymphocytes |
| Domain | Leucine-rich repeats (LRRs), a transmembrane domain and a Toll/interleukin-I receptor domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | activate NF-κB. |
| Assay used | qRT-PCR |
| PMID | 28546018 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2318 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Pf_Toll-like receptor 19 (TLR19) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Pelteobagrus fulvidraco |
| Localization | isolated peripheral blood lymphocytes |
| Domain | Leucine-rich repeats (LRRs), a transmembrane domain and a Toll/interleukin-I receptor domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | activate NF-κB. |
| Assay used | qRT-PCR |
| PMID | 28546018 |
| Year of Publication | 2017 |
| Pubchem assay | NA |