| Primary information |
|---|
| PRRID | PRRID_2311 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | SeV, flu virus, coxsackie virus, vaccinia virus, MV, RSV, retrovirus (virus)
|
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Z-loop proteolytic cleavage, and receptor dimer conformational change |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Endosomes. pDCs and B cells |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | MyD88-IRAK4/ IRAK1-IRF7. MyD88-IRAF6- IKKs-NF-jB |
| Assay used | NA |
| PMID | 28374903 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2311 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | SeV, flu virus, coxsackie virus, vaccinia virus, MV, RSV, retrovirus (virus)
|
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Z-loop proteolytic cleavage, and receptor dimer conformational change |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Endosomes. pDCs and B cells |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | MyD88-IRAK4/ IRAK1-IRF7. MyD88-IRAF6- IKKs-NF-jB |
| Assay used | NA |
| PMID | 28374903 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |