| Primary information |
|---|
| PRRID | PRRID_2301 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | rBjAVIDIN2 |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | B. japonicum |
| Localization | Hemocytes |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | phagocytosis of bacteria by macrophages, |
| Assay used | qRT-PCR |
| PMID | 28069430 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2301 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | rBjAVIDIN2 |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | B. japonicum |
| Localization | Hemocytes |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | phagocytosis of bacteria by macrophages, |
| Assay used | qRT-PCR |
| PMID | 28069430 |
| Year of Publication | 2017 |
| Pubchem assay | NA |