| Primary information |
|---|
| PRRID | PRRID_2298 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Activation of MjSRC. |
| Name of receptor | MjSRC |
| Type of receptor | Scavenger receptor (SR) |
| Source | Marsupenaeus japonicus |
| Localization | Hemocytes |
| Domain | CCP and MAM domains of MjSRC |
| Sequence of Receptor | A0A1L2DC21.fasta |
| Swiss prot ID | A0A1L2DC21 |
| Length Of Receptor | 692 |
| Function | phagocytosis of pathogenic microbes by macrophage and dendritic cell |
| Assay used | Polysacharides binding assay |
| PMID | 28602682 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2298 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Activation of MjSRC. |
| Name of receptor | MjSRC |
| Type of receptor | Scavenger receptor (SR) |
| Source | Marsupenaeus japonicus |
| Localization | Hemocytes |
| Domain | CCP and MAM domains of MjSRC |
| Sequence of Receptor | A0A1L2DC21.fasta |
| Swiss prot ID | A0A1L2DC21 |
| Length Of Receptor | 692 |
| Function | phagocytosis of pathogenic microbes by macrophage and dendritic cell |
| Assay used | Polysacharides binding assay |
| PMID | 28602682 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |