| Primary information |
|---|
| PRRID | PRRID_2204 |
| Ligand Name | Hyaluronic acid |
| Source | NA |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the production of TNF-α, IL-1β and IL-12 by dendritic cells |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | NA |
| Assay used | NA |
| PMID | 28961019 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_2204 |
| Ligand Name | Hyaluronic acid |
| Source | NA |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Induce the production of TNF-α, IL-1β and IL-12 by dendritic cells |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | NA |
| Assay used | NA |
| PMID | 28961019 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |