| Primary information |
|---|
| PRRID | PRRID_2155 |
| Ligand Name | hepta- noyl-d-Glu-meso-DAP-d-Ala (FK565) |
| Source | NA |
| Sequence of ligand | CC(C)(C)OC(=O)CCC(C(=O)O)NC(=O)OC(C)(C)C |
| Length | NA |
| Type | Agonist |
| Occurence | Synthetic |
| Role of Ligand | Agonist recognition triggers receptor oligomerization and recruitment of signaling molecules that drive NF-κB-mediated expression of inflammatory cytokines |
| Name of receptor | Nod-like receptor C1 (NLRC1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Intracellular |
| Domain | C-terminal leucine-rich regions and NOD domains |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | triggering production of β-defensins via an NF-κB signaling pathway |
| Assay used | NA |
| PMID | 28776416 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2155 |
| Ligand Name | hepta- noyl-d-Glu-meso-DAP-d-Ala (FK565) |
| Source | NA |
| Sequence of ligand | CC(C)(C)OC(=O)CCC(C(=O)O)NC(=O)OC(C)(C)C |
| Length | NA |
| Type | Agonist |
| Occurence | Synthetic |
| Role of Ligand | Agonist recognition triggers receptor oligomerization and recruitment of signaling molecules that drive NF-κB-mediated expression of inflammatory cytokines |
| Name of receptor | Nod-like receptor C1 (NLRC1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Intracellular |
| Domain | C-terminal leucine-rich regions and NOD domains |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | triggering production of β-defensins via an NF-κB signaling pathway |
| Assay used | NA |
| PMID | 28776416 |
| Year of Publication | 2017 |
| Pubchem assay | NA |