| Primary information |
|---|
| PRRID | PRRID_2074 |
| Ligand Name | Glucan |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | innate immunity elicitor |
| Name of receptor | rPtCTL-2 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Portunus trituberculatus |
| Localization | NA |
| Domain | Carbohydrate recognition Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | recognize nonself invaders and also work as an opsonin to eliminate invaders |
| Assay used | PAMPs binding assay |
| PMID | 28916358 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_2074 |
| Ligand Name | Glucan |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | innate immunity elicitor |
| Name of receptor | rPtCTL-2 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Portunus trituberculatus |
| Localization | NA |
| Domain | Carbohydrate recognition Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | recognize nonself invaders and also work as an opsonin to eliminate invaders |
| Assay used | PAMPs binding assay |
| PMID | 28916358 |
| Year of Publication | 2017 |
| Pubchem assay | NA |