| Primary information |
|---|
| PRRID | PRRID_1985 |
| Ligand Name | CL097 |
| Source | SeV, flu virus, coxsackie virus, vaccinia virus, MV, RSV, retrovirus (virus)
|
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Z-loop proteolytic cleavage, and receptor dimer conformational change |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Endosomes. Monocytes, macrophages and cDCs |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9NR97.fasta |
| Swiss prot ID | Q9NR97 |
| Length Of Receptor | 1041 |
| Function | MyD88-IRAK4/ IRAK1-IRAF6- IKKs-NF-jB |
| Assay used | NA |
| PMID | 28374903 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1985 |
| Ligand Name | CL097 |
| Source | SeV, flu virus, coxsackie virus, vaccinia virus, MV, RSV, retrovirus (virus)
|
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Z-loop proteolytic cleavage, and receptor dimer conformational change |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Endosomes. Monocytes, macrophages and cDCs |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9NR97.fasta |
| Swiss prot ID | Q9NR97 |
| Length Of Receptor | 1041 |
| Function | MyD88-IRAK4/ IRAK1-IRAF6- IKKs-NF-jB |
| Assay used | NA |
| PMID | 28374903 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |