| Primary information |
|---|
| PRRID | PRRID_1964 |
| Ligand Name | Bropirimine |
| Source | NA |
| Sequence of ligand | C1=CC=C(C=C1)C2=C(C(=O)N=C(N2)N)Br |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | Induce production of inflammatory cytokines |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | NA |
| Assay used | NA |
| PMID | 29028369 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1964 |
| Ligand Name | Bropirimine |
| Source | NA |
| Sequence of ligand | C1=CC=C(C=C1)C2=C(C(=O)N=C(N2)N)Br |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | Induce production of inflammatory cytokines |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | NA |
| Assay used | NA |
| PMID | 29028369 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |