Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1956 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1956 |
| Ligand Name | beta-1,6-linked glucans |
| Source | Fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | CLEC7A |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Human |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q9BXN2.fasta |
| Swiss prot ID | Q9BXN2 |
| Length Of Receptor | 247 |
| Function | NA |
| Assay used | NA |
| PMID | 29066255 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information | |
|---|---|
| PRRID | PRRID_1956 |
| Ligand Name | beta-1,6-linked glucans |
| Source | Fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | CLEC7A |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Human |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q9BXN2.fasta |
| Swiss prot ID | Q9BXN2 |
| Length Of Receptor | 247 |
| Function | NA |
| Assay used | NA |
| PMID | 29066255 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |