| Primary information |
|---|
| PRRID | PRRID_1946 |
| Ligand Name | b-1,3-glucans. |
| Source | Candida glabrata(fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Binding and activation of Dectin -1 |
| Name of receptor | Dectin-1 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Mice |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9BXN2.fasta |
| Swiss prot ID | Q9BXN2 |
| Length Of Receptor | 247 |
| Function | activation of the NF-κB and MAPK pathways |
| Assay used | Binding assay |
| PMID | 28658592 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1946 |
| Ligand Name | b-1,3-glucans. |
| Source | Candida glabrata(fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Binding and activation of Dectin -1 |
| Name of receptor | Dectin-1 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Mice |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9BXN2.fasta |
| Swiss prot ID | Q9BXN2 |
| Length Of Receptor | 247 |
| Function | activation of the NF-κB and MAPK pathways |
| Assay used | Binding assay |
| PMID | 28658592 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |