| Primary information |
|---|
| PRRID | PRRID_1944 |
| Ligand Name | b-1,3-glucans. |
| Source | Gram negative Bacteria (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | MsMBP |
| Type of receptor | Mannose binding protein (MBP) |
| Source | Manduca sexta |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 27989837 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1944 |
| Ligand Name | b-1,3-glucans. |
| Source | Gram negative Bacteria (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | MsMBP |
| Type of receptor | Mannose binding protein (MBP) |
| Source | Manduca sexta |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 27989837 |
| Year of Publication | 2017 |
| Pubchem assay | NA |