Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1941 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1941 |
| Ligand Name | b-1,3-glucans. |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Glycoprotein |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | DmGNBP2 |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Drosophila melanogaster |
| Localization | membrane localised |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 29229443 |
| Year of Publication | 2017 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_1941 |
| Ligand Name | b-1,3-glucans. |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Glycoprotein |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | DmGNBP2 |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Drosophila melanogaster |
| Localization | membrane localised |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 29229443 |
| Year of Publication | 2017 |
| Pubchem assay | NA |