| Primary information |
|---|
| PRRID | PRRID_1937 |
| Ligand Name | b-1,3-glucan and lipopolysaccharide |
| Source | Gram positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | DmGNBP1 |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Drosophila melanogaster |
| Localization | membrane localised |
| Domain | NA |
| Sequence of Receptor | Q9NHB0.fasta |
| Swiss prot ID | Q9NHB0 |
| Length Of Receptor | 494 |
| Function | NA |
| Assay used | NA |
| PMID | 29229443 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1937 |
| Ligand Name | b-1,3-glucan and lipopolysaccharide |
| Source | Gram positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | DmGNBP1 |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Drosophila melanogaster |
| Localization | membrane localised |
| Domain | NA |
| Sequence of Receptor | Q9NHB0.fasta |
| Swiss prot ID | Q9NHB0 |
| Length Of Receptor | 494 |
| Function | NA |
| Assay used | NA |
| PMID | 29229443 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |