| Primary information |
|---|
| PRRID | PRRID_1926 |
| Ligand Name | ATP |
| Source | NA |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nod-like receptor P3 (NLRP3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | Microglia |
| Domain | NA |
| Sequence of Receptor | Q8R4B8.fasta |
| Swiss prot ID | Q8R4B8 |
| Length Of Receptor | 1033 |
| Function | NLRP3 inflammasome activation in AD models |
| Assay used | NA |
| PMID | 28805121 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1926 |
| Ligand Name | ATP |
| Source | NA |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Nod-like receptor P3 (NLRP3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | Microglia |
| Domain | NA |
| Sequence of Receptor | Q8R4B8.fasta |
| Swiss prot ID | Q8R4B8 |
| Length Of Receptor | 1033 |
| Function | NLRP3 inflammasome activation in AD models |
| Assay used | NA |
| PMID | 28805121 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |