Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1890 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1890 |
| Ligand Name | 1,3 beta glucan |
| Source | Candida albicans(fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Dectin-1 (Clec7a) |
| Type of receptor | Syk-coupled CLR |
| Source | Mice |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q6QLQ4.fasta |
| Swiss prot ID | Q6QLQ4 |
| Length Of Receptor | 244 |
| Function | protective role in infection model |
| Assay used | NA |
| PMID | 28167651 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |
| Primary information | |
|---|---|
| PRRID | PRRID_1890 |
| Ligand Name | 1,3 beta glucan |
| Source | Candida albicans(fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Dectin-1 (Clec7a) |
| Type of receptor | Syk-coupled CLR |
| Source | Mice |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q6QLQ4.fasta |
| Swiss prot ID | Q6QLQ4 |
| Length Of Receptor | 244 |
| Function | protective role in infection model |
| Assay used | NA |
| PMID | 28167651 |
| Year of Publication | 2017 |
| Pubchem assay | Pubchem_assay |