Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1888 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1888 |
| Ligand Name | β­glucan |
| Source | pathogenic fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Glycoprotein |
| Occurence | Natural |
| Role of Ligand | Fungal infection |
| Name of receptor | Dectin-1 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | NA |
| Localization | macrophages, den- dritic cells, neutrophils, and a subset of T and B cells |
| Domain | carbohydrate domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | phagocytosis of fungi |
| Assay used | NA |
| PMID | 27288407 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_1888 |
| Ligand Name | β­glucan |
| Source | pathogenic fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Glycoprotein |
| Occurence | Natural |
| Role of Ligand | Fungal infection |
| Name of receptor | Dectin-1 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | NA |
| Localization | macrophages, den- dritic cells, neutrophils, and a subset of T and B cells |
| Domain | carbohydrate domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | phagocytosis of fungi |
| Assay used | NA |
| PMID | 27288407 |
| Year of Publication | 2016 |
| Pubchem assay | NA |