Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1887 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1887 |
| Ligand Name | β -1,3-glucan |
| Source | NA |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | GRP2 |
| Type of receptor | Gastrin-releasing peptide receptor (GRP) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 26504233 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_1887 |
| Ligand Name | β -1,3-glucan |
| Source | NA |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | GRP2 |
| Type of receptor | Gastrin-releasing peptide receptor (GRP) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 26504233 |
| Year of Publication | 2016 |
| Pubchem assay | NA |