| Primary information |
|---|
| PRRID | PRRID_1878 |
| Ligand Name | Triacetylated lipoproteins |
| Source | Mycobacteria (Bacteria) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 1 (TLR1) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Plasma membrane |
| Domain | extracellular domain containing leucine-rich repeats and an intracellular domain that contains a conserved region called the Toll/IL-1 receptor (TIR) domain and the trans membrane domain |
| Sequence of Receptor | Q9EPQ1.fasta |
| Swiss prot ID | Q9EPQ1 |
| Length Of Receptor | 795 |
| Function | increase TNF-a and IL-6 |
| Assay used | NA |
| PMID | 27756604 |
| Year of Publication | 2016 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1878 |
| Ligand Name | Triacetylated lipoproteins |
| Source | Mycobacteria (Bacteria) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 1 (TLR1) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Plasma membrane |
| Domain | extracellular domain containing leucine-rich repeats and an intracellular domain that contains a conserved region called the Toll/IL-1 receptor (TIR) domain and the trans membrane domain |
| Sequence of Receptor | Q9EPQ1.fasta |
| Swiss prot ID | Q9EPQ1 |
| Length Of Receptor | 795 |
| Function | increase TNF-a and IL-6 |
| Assay used | NA |
| PMID | 27756604 |
| Year of Publication | 2016 |
| Pubchem assay | Pubchem_assay |