| Primary information |
|---|
| PRRID | PRRID_1852 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | LcNTC |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Larimichthys crocea |
| Localization | liver, spleen and head-kidney |
| Domain | CRD with four conserved disulfide-bonded cysteine residues (Cys -Cys , Cys -Cys ) and EPN/AND motifs |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Serve as a PRR involved in fish defense against virus, bacteria and parasites infection through recognizing carbohydrates on the surface of pathogens. |
| Assay used | Bacterial agglutination assay |
| PMID | 26828263 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1852 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | LcNTC |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Larimichthys crocea |
| Localization | liver, spleen and head-kidney |
| Domain | CRD with four conserved disulfide-bonded cysteine residues (Cys -Cys , Cys -Cys ) and EPN/AND motifs |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Serve as a PRR involved in fish defense against virus, bacteria and parasites infection through recognizing carbohydrates on the surface of pathogens. |
| Assay used | Bacterial agglutination assay |
| PMID | 26828263 |
| Year of Publication | 2016 |
| Pubchem assay | NA |