| Primary information |
|---|
| PRRID | PRRID_1849 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | CnToll-like receptor 1 (TLR-1) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Chlamys nobilis |
| Localization | mantle, he- mocytes, gill, kidney, gonad, hepatopancreas |
| Domain | five leucine-rich repeats (LRR), two LRR-C-terminal (LRRCT) motifs and a LRR-N-terminal (LRRNT) motif in the extracellular domain, a transmembrane domain and a Toll/Interleukin-1 Receptor (TIR) of 138 |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | binds to microbes and act as PRR. |
| Assay used | qRT-PCR |
| PMID | 27403592 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1849 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | CnToll-like receptor 1 (TLR-1) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Chlamys nobilis |
| Localization | mantle, he- mocytes, gill, kidney, gonad, hepatopancreas |
| Domain | five leucine-rich repeats (LRR), two LRR-C-terminal (LRRCT) motifs and a LRR-N-terminal (LRRNT) motif in the extracellular domain, a transmembrane domain and a Toll/Interleukin-1 Receptor (TIR) of 138 |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | binds to microbes and act as PRR. |
| Assay used | qRT-PCR |
| PMID | 27403592 |
| Year of Publication | 2016 |
| Pubchem assay | NA |