| Primary information |
|---|
| PRRID | PRRID_1847 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Zebrafish |
| Localization | Plasma membrane |
| Domain | extracellular (or intra- endosomal) ligand-binding domain with a leucine-rich repeat (LRR) motif and a cytoplasmic signaling Toll/Interleukin-1 (IL-1) receptor homology (TIR) domain |
| Sequence of Receptor | B8JIL3.fasta |
| Swiss prot ID | B8JIL3 |
| Length Of Receptor | 903 |
| Function | induce IFN expression |
| Assay used | NA |
| PMID | 27721456 |
| Year of Publication | 2016 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1847 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Zebrafish |
| Localization | Plasma membrane |
| Domain | extracellular (or intra- endosomal) ligand-binding domain with a leucine-rich repeat (LRR) motif and a cytoplasmic signaling Toll/Interleukin-1 (IL-1) receptor homology (TIR) domain |
| Sequence of Receptor | B8JIL3.fasta |
| Swiss prot ID | B8JIL3 |
| Length Of Receptor | 903 |
| Function | induce IFN expression |
| Assay used | NA |
| PMID | 27721456 |
| Year of Publication | 2016 |
| Pubchem assay | Pubchem_assay |