| Primary information |
|---|
| PRRID | PRRID_1842 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Hexokinase |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Human |
| Localization | Macrophages, Dendritic cells |
| Domain | NA |
| Sequence of Receptor | P52789.fasta |
| Swiss prot ID | P52789 |
| Length Of Receptor | 917 |
| Function | Metabolic enzyme, Trigger NLRP3 Inflammasome Activation and IL-1b Production |
| Assay used | Proximity Ligation assay |
| PMID | 27374331 |
| Year of Publication | 2016 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1842 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Hexokinase |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Human |
| Localization | Macrophages, Dendritic cells |
| Domain | NA |
| Sequence of Receptor | P52789.fasta |
| Swiss prot ID | P52789 |
| Length Of Receptor | 917 |
| Function | Metabolic enzyme, Trigger NLRP3 Inflammasome Activation and IL-1b Production |
| Assay used | Proximity Ligation assay |
| PMID | 27374331 |
| Year of Publication | 2016 |
| Pubchem assay | Pubchem_assay |