| Primary information |
|---|
| PRRID | PRRID_1839 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Bacterial infection |
| Name of receptor | CgPGRPS4 |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | Crassostrea gigas |
| Localization | Cytoplasm |
| Domain | one typical PGRP/amidase domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Activate NF-kB |
| Assay used | PAMPs binding assay |
| PMID | 28042081 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1839 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Bacterial infection |
| Name of receptor | CgPGRPS4 |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | Crassostrea gigas |
| Localization | Cytoplasm |
| Domain | one typical PGRP/amidase domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Activate NF-kB |
| Assay used | PAMPs binding assay |
| PMID | 28042081 |
| Year of Publication | 2016 |
| Pubchem assay | NA |