Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1801 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1801 |
| Ligand Name | Mannan |
| Source | S. cerevisiae (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)O)CO)CO)CO)O)O)O)O |
| Length | NA |
| Type | Polysaccharides |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Activate NF-Kb |
| Assay used | NA |
| PMID | 27293318 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_1801 |
| Ligand Name | Mannan |
| Source | S. cerevisiae (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)O)CO)CO)CO)O)O)O)O |
| Length | NA |
| Type | Polysaccharides |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Activate NF-Kb |
| Assay used | NA |
| PMID | 27293318 |
| Year of Publication | 2016 |
| Pubchem assay | NA |