Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1756 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1756 |
| Ligand Name | Lewis antigens |
| Source | Mycobacterium spp., H. pylori, Lactobacillus spp., Leishmania spp., HIV-1, Dengue virus, Measles vir |
| Sequence of ligand | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)CO)O)NC(=O)C)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | DC-SIGN |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Human |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q9H2X3.fasta |
| Swiss prot ID | Q9H2X3 |
| Length Of Receptor | 399 |
| Function | Pathogen recognition; Antigen uptake; APC/T cell interactions; Cell migration |
| Assay used | NA |
| PMID | 27999992 |
| Year of Publication | 2016 |
| Pubchem assay | Pubchem_assay |
| Primary information | |
|---|---|
| PRRID | PRRID_1756 |
| Ligand Name | Lewis antigens |
| Source | Mycobacterium spp., H. pylori, Lactobacillus spp., Leishmania spp., HIV-1, Dengue virus, Measles vir |
| Sequence of ligand | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)CO)O)NC(=O)C)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | DC-SIGN |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Human |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q9H2X3.fasta |
| Swiss prot ID | Q9H2X3 |
| Length Of Receptor | 399 |
| Function | Pathogen recognition; Antigen uptake; APC/T cell interactions; Cell migration |
| Assay used | NA |
| PMID | 27999992 |
| Year of Publication | 2016 |
| Pubchem assay | Pubchem_assay |