| Primary information |
|---|
| PRRID | PRRID_1745 |
| Ligand Name | Glucan |
| Source | S. cerevisiae (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | It enhances microbe agglutination and haemocytes encapsulation. |
| Name of receptor | Galectin |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Eriocheir sinensis |
| Localization | Hepatopancreas |
| Domain | CRD |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It provies immune defense against invading microbes. |
| Assay used | ELISA |
| PMID | 27095174 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1745 |
| Ligand Name | Glucan |
| Source | S. cerevisiae (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | It enhances microbe agglutination and haemocytes encapsulation. |
| Name of receptor | Galectin |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Eriocheir sinensis |
| Localization | Hepatopancreas |
| Domain | CRD |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It provies immune defense against invading microbes. |
| Assay used | ELISA |
| PMID | 27095174 |
| Year of Publication | 2016 |
| Pubchem assay | NA |