| Primary information |
|---|
| PRRID | PRRID_1744 |
| Ligand Name | Galactomannan |
| Source | Aspergillus fumigatus(fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)O)O)O)OC3C(C(C(C(O3)CO)O)O)O)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Downregulates the IL-6 and TNF- production |
| Assay used | NA |
| PMID | 26775799 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1744 |
| Ligand Name | Galactomannan |
| Source | Aspergillus fumigatus(fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)O)O)O)OC3C(C(C(C(O3)CO)O)O)O)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Downregulates the IL-6 and TNF- production |
| Assay used | NA |
| PMID | 26775799 |
| Year of Publication | 2016 |
| Pubchem assay | NA |