| Primary information |
|---|
| PRRID | PRRID_1716 |
| Ligand Name | b-1,3-glucans. |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Lipopolysaccharide and b-1, 3-glucan binding protein (LGBP) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Fenneropenaeus merguiensis |
| Localization | Hepatopancreas |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Activate NF-KB |
| Assay used | ELISA |
| PMID | 27431930 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1716 |
| Ligand Name | b-1,3-glucans. |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Lipopolysaccharide and b-1, 3-glucan binding protein (LGBP) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Fenneropenaeus merguiensis |
| Localization | Hepatopancreas |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Activate NF-KB |
| Assay used | ELISA |
| PMID | 27431930 |
| Year of Publication | 2016 |
| Pubchem assay | NA |