| Primary information |
|---|
| PRRID | PRRID_1707 |
| Ligand Name | 3M-002 |
| Source | NA |
| Sequence of ligand | CCCC1=NC2=C(S1)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | RDToll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Chinese raccoon dog |
| Localization | peripheral blood mononuclear cells (PBMCs) |
| Domain | 19 leucine-rich repeats (LRRs) in the extracel- lular domain and a cytoplasmic TIR domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | proinflammatory cytokines TNF- a and IFN-a upregulation |
| Assay used | qRT-PCR |
| PMID | 27481482 |
| Year of Publication | 2016 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1707 |
| Ligand Name | 3M-002 |
| Source | NA |
| Sequence of ligand | CCCC1=NC2=C(S1)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | RDToll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Chinese raccoon dog |
| Localization | peripheral blood mononuclear cells (PBMCs) |
| Domain | 19 leucine-rich repeats (LRRs) in the extracel- lular domain and a cytoplasmic TIR domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | proinflammatory cytokines TNF- a and IFN-a upregulation |
| Assay used | qRT-PCR |
| PMID | 27481482 |
| Year of Publication | 2016 |
| Pubchem assay | NA |