| Primary information |
|---|
| PRRID | PRRID_1696 |
| Ligand Name | Imiquimod |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | TLR7 stimulation induces apoptosis of neurons via SARM1 signalling pathway |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Primary cortical neurons |
| Domain | NA |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | It resulted in neuronal apoptosis in primary cortical neuronal cultures and olfactory sensory neurons. |
| Assay used | MTT assay |
| PMID | 26423149 |
| Year of Publication | 2015 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1696 |
| Ligand Name | Imiquimod |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | TLR7 stimulation induces apoptosis of neurons via SARM1 signalling pathway |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Primary cortical neurons |
| Domain | NA |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | It resulted in neuronal apoptosis in primary cortical neuronal cultures and olfactory sensory neurons. |
| Assay used | MTT assay |
| PMID | 26423149 |
| Year of Publication | 2015 |
| Pubchem assay | Pubchem_assay |