Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1694 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1694 |
| Ligand Name | Fucoidan |
| Source | NA |
| Sequence of ligand | CC1C(C(C(C(O1)C)OS(=O)(=O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | LvLGBP |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Litopenaeus vannamei |
| Localization | Hemocytes |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | cause degranulation, and activate the proPO system that subsequently leads to an increase in PO activity, indicating the activation of innate immunity. |
| Assay used | ELISA |
| PMID | 26522339 |
| Year of Publication | 2015 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_1694 |
| Ligand Name | Fucoidan |
| Source | NA |
| Sequence of ligand | CC1C(C(C(C(O1)C)OS(=O)(=O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | LvLGBP |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Litopenaeus vannamei |
| Localization | Hemocytes |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | cause degranulation, and activate the proPO system that subsequently leads to an increase in PO activity, indicating the activation of innate immunity. |
| Assay used | ELISA |
| PMID | 26522339 |
| Year of Publication | 2015 |
| Pubchem assay | NA |