| Primary information |
|---|
| PRRID | PRRID_1674 |
| Ligand Name | VTX-2337 |
| Source | mimics viral single-stranded ribonucleic acid (ssRNA) (virus) |
| Sequence of ligand | CCCN(CCC)C(=O)C1=CC2=C(C=C(C=C2)C3=CC=C(C=C3)C(=O)N4CCCC4)N=C(C1)N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | stimulates TLR8 |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | TLR8 is expressed on mDCs, monocytes, and NK cells in humans |
| Domain | cell compartment |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | TLR8 is expected to stimulate the release of distinct inflammatory mediators, including Th1- polarizing cytokines, chemokines, and other acute phase proteins |
| Assay used | NA |
| PMID | 24807889 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1674 |
| Ligand Name | VTX-2337 |
| Source | mimics viral single-stranded ribonucleic acid (ssRNA) (virus) |
| Sequence of ligand | CCCN(CCC)C(=O)C1=CC2=C(C=C(C=C2)C3=CC=C(C=C3)C(=O)N4CCCC4)N=C(C1)N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | stimulates TLR8 |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | TLR8 is expressed on mDCs, monocytes, and NK cells in humans |
| Domain | cell compartment |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | TLR8 is expected to stimulate the release of distinct inflammatory mediators, including Th1- polarizing cytokines, chemokines, and other acute phase proteins |
| Assay used | NA |
| PMID | 24807889 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |