| Primary information |
|---|
| PRRID | PRRID_1653 |
| Ligand Name | Triacetylated lipoproteins |
| Source | Bacteria |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 1/2 (TLR1/2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | monocyte/macrophages, DCs, B-lymphocytes |
| Domain | extracellular domains of leucine-rich repeat motifs |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | NA |
| PMID | 24754320 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1653 |
| Ligand Name | Triacetylated lipoproteins |
| Source | Bacteria |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 1/2 (TLR1/2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | monocyte/macrophages, DCs, B-lymphocytes |
| Domain | extracellular domains of leucine-rich repeat motifs |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | NA |
| PMID | 24754320 |
| Year of Publication | 2014 |
| Pubchem assay | NA |