| Primary information |
|---|
| PRRID | PRRID_1650 |
| Ligand Name | Tri-DAP |
| Source | Gram-positive and negative bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)NC(CCCC(C(=O)O)N)C(=O)O)C(=O)O)N |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | activate NF-κB |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | macrophages and mesothelial cells |
| Domain | serine/threonine RIP2 (RICK, CARDIAK) kinase |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | interacts with IKK to trigger the activation of NF-kB and the production of inflammatory cytokines, such as TNF-a and IL-6 |
| Assay used | ELISA |
| PMID | 24766550 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1650 |
| Ligand Name | Tri-DAP |
| Source | Gram-positive and negative bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)NC(CCCC(C(=O)O)N)C(=O)O)C(=O)O)N |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | activate NF-κB |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | macrophages and mesothelial cells |
| Domain | serine/threonine RIP2 (RICK, CARDIAK) kinase |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | interacts with IKK to trigger the activation of NF-kB and the production of inflammatory cytokines, such as TNF-a and IL-6 |
| Assay used | ELISA |
| PMID | 24766550 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |