| Primary information |
|---|
| PRRID | PRRID_1645 |
| Ligand Name | tacrolimus |
| Source | NA |
| Sequence of ligand | CC1CC(C2C(CC(C(O2)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C(CC(=O)C(C=C(C1)C)CC=C)O)C)C(=CC4CCC(C(C4)OC)O)C)O)C)OC)OC |
| Length | NA |
| Type | NA |
| Occurence | Synthetic |
| Role of Ligand | Immuno suppressive drug |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | lIver |
| Domain | cell surface |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | ELISA |
| PMID | 24820765 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1645 |
| Ligand Name | tacrolimus |
| Source | NA |
| Sequence of ligand | CC1CC(C2C(CC(C(O2)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C(CC(=O)C(C=C(C1)C)CC=C)O)C)C(=CC4CCC(C(C4)OC)O)C)O)C)OC)OC |
| Length | NA |
| Type | NA |
| Occurence | Synthetic |
| Role of Ligand | Immuno suppressive drug |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | lIver |
| Domain | cell surface |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | ELISA |
| PMID | 24820765 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |