| Primary information |
|---|
| PRRID | PRRID_1605 |
| Ligand Name | Resveratrol (Res, 3,4’,5-trihydroxy-trans-stilbene) |
| Source | grapes and red wine (plant) |
| Sequence of ligand | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| Length | NA |
| Type | polyphenol |
| Occurence | Natural |
| Role of Ligand | inhibition of tumor initiation, anti‚Äêinflammatory, lipid modification, anti‚Äêoxidative, neuro- protective and anti-aging effects |
| Name of receptor | Toll-like receptor 4 (TLR4) ( myd88, NF-κB) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages, Myeloid DCs, neutrophils, Mast cells, B-lymphocyte |
| Domain | cell surface |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | ELISA |
| PMID | 24818579 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1605 |
| Ligand Name | Resveratrol (Res, 3,4’,5-trihydroxy-trans-stilbene) |
| Source | grapes and red wine (plant) |
| Sequence of ligand | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| Length | NA |
| Type | polyphenol |
| Occurence | Natural |
| Role of Ligand | inhibition of tumor initiation, anti‚Äêinflammatory, lipid modification, anti‚Äêoxidative, neuro- protective and anti-aging effects |
| Name of receptor | Toll-like receptor 4 (TLR4) ( myd88, NF-κB) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages, Myeloid DCs, neutrophils, Mast cells, B-lymphocyte |
| Domain | cell surface |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | ELISA |
| PMID | 24818579 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |