| Primary information |
|---|
| PRRID | PRRID_1598 |
| Ligand Name | R848 |
| Source | Virus |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | immune modulators |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | plasmacytoid and myeloid DCs |
| Domain | cell compartment |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | important role in the immune response to viral infection |
| Assay used | ELISA |
| PMID | 24771328 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1598 |
| Ligand Name | R848 |
| Source | Virus |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | immune modulators |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | plasmacytoid and myeloid DCs |
| Domain | cell compartment |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | important role in the immune response to viral infection |
| Assay used | ELISA |
| PMID | 24771328 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |