| Primary information |
|---|
| PRRID | PRRID_1587 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | poly I:C expressed significantly higher levels of IFN-a1 and IFN-c and Mx |
| Name of receptor | Toll-like receptor 22a1 (TLR22a1) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Atlantic salmon (Salmo salar) |
| Localization | muscle, head kidney, liver, gut, heart, spleen and gill |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | paralleled TLR3 up-regulation in virus- infected fish |
| Assay used | Real-time PCR |
| PMID | 24736205 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1587 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | poly I:C expressed significantly higher levels of IFN-a1 and IFN-c and Mx |
| Name of receptor | Toll-like receptor 22a1 (TLR22a1) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Atlantic salmon (Salmo salar) |
| Localization | muscle, head kidney, liver, gut, heart, spleen and gill |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | paralleled TLR3 up-regulation in virus- infected fish |
| Assay used | Real-time PCR |
| PMID | 24736205 |
| Year of Publication | 2014 |
| Pubchem assay | NA |