| Primary information |
|---|
| PRRID | PRRID_1568 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | act as a TLR3 agonist and induces protective responses against rapidly growing tumor cells |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | pDCs |
| Domain | intracellular receptors |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | important role in the immune response to viral infection |
| Assay used | flow cytometry analysis, Immunofluorescence, Quantitative polymerase chain reaction (qPCR), enzyme-linked immunosorbent assay (ELISA |
| PMID | 24814238 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1568 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | act as a TLR3 agonist and induces protective responses against rapidly growing tumor cells |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | pDCs |
| Domain | intracellular receptors |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | important role in the immune response to viral infection |
| Assay used | flow cytometry analysis, Immunofluorescence, Quantitative polymerase chain reaction (qPCR), enzyme-linked immunosorbent assay (ELISA |
| PMID | 24814238 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |