| Primary information |
|---|
| PRRID | PRRID_1567 |
| Ligand Name | poly I:C +CpG-ODN |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | highly immunostimulatory |
| Name of receptor | NA |
| Type of receptor | NA |
| Source | Chicken |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | highly immunostimulatory and show synergistic effect in cytokine production |
| Assay used | ELISA |
| PMID | 24797893 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1567 |
| Ligand Name | poly I:C +CpG-ODN |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | highly immunostimulatory |
| Name of receptor | NA |
| Type of receptor | NA |
| Source | Chicken |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | highly immunostimulatory and show synergistic effect in cytokine production |
| Assay used | ELISA |
| PMID | 24797893 |
| Year of Publication | 2014 |
| Pubchem assay | NA |