| Primary information |
|---|
| PRRID | PRRID_1560 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram negative Bacteria (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | European and African Children |
| Localization | most adult tissues |
| Domain | signals via a caspase- activated recruitment domain (CARD) |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | induce autophagy and inflammatory responses in host cells. |
| Assay used | ELISA |
| PMID | 24746552 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1560 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram negative Bacteria (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | European and African Children |
| Localization | most adult tissues |
| Domain | signals via a caspase- activated recruitment domain (CARD) |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | induce autophagy and inflammatory responses in host cells. |
| Assay used | ELISA |
| PMID | 24746552 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |